C33H31N3O — CID 153379814
(2Z)-4-methyl-2-[[(7S)-7-methyl-3-phenyl-1-(4-phenylphenyl)-5,6-dihydro-4H-indazol-7-yl]methylidene]-3-oxopentanenitrile (PubChem CID 153379814) has the molecular formula C33H31N3O and a molecular weight of 485.63 g/mol. Its IUPAC name is (2Z)-4-methyl-2-[[(7S)-7-methyl-3-phenyl-1-(4-phenylphenyl)-5,6-dihydro-4H-indazol-7-yl]methylidene]-3-oxopentanenitrile.
| Compound Name | (2Z)-4-methyl-2-[[(7S)-7-methyl-3-phenyl-1-(4-phenylphenyl)-5,6-dihydro-4H-indazol-7-yl]methylidene]-3-oxopentanenitrile |
|---|---|
| PubChem CID | 153379814 |
| Molecular Formula | C33H31N3O |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (2Z)-4-methyl-2-[[(7S)-7-methyl-3-phenyl-1-(4-phenylphenyl)-5,6-dihydro-4H-indazol-7-yl]methylidene]-3-oxopentanenitrile |
| SMILES | CC(C)C(=O)/C(C#N)=C\[C@]1(C)CCCc2c(-c3ccccc3)nn(-c3ccc(-c4ccccc4)cc3)c21 |
| InChI | InChI=1S/C33H31N3O/c1-23(2)31(37)27(22-34)21-33(3)20-10-15-29-30(26-13-8-5-9-14-26)35-36(32(29)33)28-18-16-25(17-19-28)24-11-6-4-7-12-24/h4-9,11-14,16-19,21,23H,10,15,20H2,1-3H3/b27-21-/t33-/m0/s1 |
| InChIKey | HAYWANBEUQEROH-LNAZBPSHSA-N |
| XLogP | 7.48 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|