C12H18F3N5O3 — CID 153380488
1-[5-amino-3-nitro-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 153380488) has the molecular formula C12H18F3N5O3 and a molecular weight of 337.30 g/mol. Its IUPAC name is 1-[5-amino-3-nitro-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | 1-[5-amino-3-nitro-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 153380488 |
| Molecular Formula | C12H18F3N5O3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[5-amino-3-nitro-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CNCC(c1nc(OCC(F)(F)F)c(N)cc1[N+](=O)[O-])N(C)C |
| InChI | InChI=1S/C12H18F3N5O3/c1-17-5-9(19(2)3)10-8(20(21)22)4-7(16)11(18-10)23-6-12(13,14)15/h4,9,17H,5-6,16H2,1-3H3 |
| InChIKey | VBMNDSNDEZDBDC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 106.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|