C29H34N2O2 — CID 153381825
methanol;1-[(2-methylphenyl)methyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole-5-carbaldehyde (PubChem CID 153381825) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is methanol;1-[(2-methylphenyl)methyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole-5-carbaldehyde.
| Compound Name | methanol;1-[(2-methylphenyl)methyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 153381825 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | methanol;1-[(2-methylphenyl)methyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole-5-carbaldehyde |
| SMILES | CO.Cc1ccccc1Cn1c(C(C)c2ccc(CC(C)C)cc2)nc2cc(C=O)ccc21 |
| InChI | InChI=1S/C28H30N2O.CH4O/c1-19(2)15-22-9-12-24(13-10-22)21(4)28-29-26-16-23(18-31)11-14-27(26)30(28)17-25-8-6-5-7-20(25)3;1-2/h5-14,16,18-19,21H,15,17H2,1-4H3;2H,1H3 |
| InChIKey | CKPUHMFOIFXPNU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|