C22H32F2N8 — CID 153382684
(1Z,3Z)-1-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-4-[2,5-difluoro-4-(1H-pyrazol-4-yl)phenyl]buta-1,3-diene-1,2,4-triamine (PubChem CID 153382684) has the molecular formula C22H32F2N8 and a molecular weight of 446.55 g/mol. Its IUPAC name is (1Z,3Z)-1-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-4-[2,5-difluoro-4-(1H-pyrazol-4-yl)phenyl]buta-1,3-diene-1,2,4-triamine.
| Compound Name | (1Z,3Z)-1-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-4-[2,5-difluoro-4-(1H-pyrazol-4-yl)phenyl]buta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 153382684 |
| Molecular Formula | C22H32F2N8 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (1Z,3Z)-1-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-4-[2,5-difluoro-4-(1H-pyrazol-4-yl)phenyl]buta-1,3-diene-1,2,4-triamine |
| SMILES | CC1(C)CC(N(N)/C(N)=C(N)/C=C(\N)c2cc(F)c(-c3cn[nH]c3)cc2F)CC(C)(C)N1 |
| InChI | InChI=1S/C22H32F2N8/c1-21(2)8-13(9-22(3,4)31-21)32(28)20(27)19(26)7-18(25)15-6-16(23)14(5-17(15)24)12-10-29-30-11-12/h5-7,10-11,13,31H,8-9,25-28H2,1-4H3,(H,29,30)/b18-7-,20-19- |
| InChIKey | ZRRUDBBGNRXGFP-PKAXEZAOSA-N |
| XLogP | 2.23 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|