C20H30F2N4O — CID 146238310
2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-4,5-difluorophenol (PubChem CID 146238310) has the molecular formula C20H30F2N4O and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-4,5-difluorophenol.
| Compound Name | 2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-4,5-difluorophenol |
|---|---|
| PubChem CID | 146238310 |
| Molecular Formula | C20H30F2N4O |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-4,5-difluorophenol |
| SMILES | CN(/C(N)=C/C=C(\N)c1cc(F)c(F)cc1O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H30F2N4O/c1-19(2)10-12(11-20(3,4)25-19)26(5)18(24)7-6-16(23)13-8-14(21)15(22)9-17(13)27/h6-9,12,25,27H,10-11,23-24H2,1-5H3/b16-6-,18-7+ |
| InChIKey | NGBDJOALDVEVNT-FAKNLOEVSA-N |
| XLogP | 3.01 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|