C20H31FN4O — CID 167227795
2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-5-fluorophenol (PubChem CID 167227795) has the molecular formula C20H31FN4O and a molecular weight of 362.49 g/mol. Its IUPAC name is 2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-5-fluorophenol.
| Compound Name | 2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-5-fluorophenol |
|---|---|
| PubChem CID | 167227795 |
| Molecular Formula | C20H31FN4O |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-5-fluorophenol |
| SMILES | CN(/C(N)=C/C=C(\N)c1ccc(F)cc1O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H31FN4O/c1-19(2)11-14(12-20(3,4)24-19)25(5)18(23)9-8-16(22)15-7-6-13(21)10-17(15)26/h6-10,14,24,26H,11-12,22-23H2,1-5H3/b16-8-,18-9+ |
| InChIKey | FFKILDGHFYVCBX-UBSSTWLLSA-N |
| XLogP | 2.87 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|