C24H41FN8O — CID 153382846
5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-4-fluoro-2-[(1Z,3Z)-1,3,4-triamino-4-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]phenol;ethane (PubChem CID 153382846) has the molecular formula C24H41FN8O and a molecular weight of 476.65 g/mol. Its IUPAC name is 5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-4-fluoro-2-[(1Z,3Z)-1,3,4-triamino-4-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]phenol;ethane.
| Compound Name | 5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-4-fluoro-2-[(1Z,3Z)-1,3,4-triamino-4-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]phenol;ethane |
|---|---|
| PubChem CID | 153382846 |
| Molecular Formula | C24H41FN8O |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | 5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-4-fluoro-2-[(1Z,3Z)-1,3,4-triamino-4-[amino-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]phenol;ethane |
| SMILES | CC.[H]/N=C/C(=C\N)c1cc(O)c(/C(N)=C/C(N)=C(\N)N(N)C2CC(C)(C)NC(C)(C)C2)cc1F |
| InChI | InChI=1S/C22H35FN8O.C2H6/c1-21(2)8-13(9-22(3,4)30-21)31(29)20(28)18(27)7-17(26)15-5-16(23)14(6-19(15)32)12(10-24)11-25;1-2/h5-7,10-11,13,24,30,32H,8-9,25-29H2,1-4H3;1-2H3/b12-11+,17-7-,20-18-,24-10+; |
| InChIKey | MSNLNZFPVLONAE-CHEKCLFBSA-N |
| XLogP | 2.38 |
| TPSA | 189.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|