C25H34N6O — CID 144786423
6-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-7-hydroxy-2-methylquinoline-4-carbonitrile (PubChem CID 144786423) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is 6-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-7-hydroxy-2-methylquinoline-4-carbonitrile.
| Compound Name | 6-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-7-hydroxy-2-methylquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 144786423 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 6-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-7-hydroxy-2-methylquinoline-4-carbonitrile |
| SMILES | Cc1cc(C#N)c2cc(/C(N)=C/C=C(\N)N(C)C3CC(C)(C)NC(C)(C)C3)c(O)cc2n1 |
| InChI | InChI=1S/C25H34N6O/c1-15-9-16(14-26)18-10-19(22(32)11-21(18)29-15)20(27)7-8-23(28)31(6)17-12-24(2,3)30-25(4,5)13-17/h7-11,17,30,32H,12-13,27-28H2,1-6H3/b20-7-,23-8+ |
| InChIKey | SHAMNFAQIWFGIW-VFINQLGGSA-N |
| XLogP | 3.46 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|