C26H37N5O2 — CID 144574653
2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-methoxy-5-pyridin-3-ylphenol (PubChem CID 144574653) has the molecular formula C26H37N5O2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-methoxy-5-pyridin-3-ylphenol.
| Compound Name | 2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-methoxy-5-pyridin-3-ylphenol |
|---|---|
| PubChem CID | 144574653 |
| Molecular Formula | C26H37N5O2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 2-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-3-methoxy-5-pyridin-3-ylphenol |
| SMILES | COc1cc(-c2cccnc2)cc(O)c1/C(N)=C/C=C(\N)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C26H37N5O2/c1-25(2)14-19(15-26(3,4)30-25)31(5)23(28)10-9-20(27)24-21(32)12-18(13-22(24)33-6)17-8-7-11-29-16-17/h7-13,16,19,30,32H,14-15,27-28H2,1-6H3/b20-9-,23-10+ |
| InChIKey | KDRASXXGJLWFMC-MFGSSXBZSA-N |
| XLogP | 3.80 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|