C24H30N6S — CID 146292458
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-cyano-4-pyridin-3-ylbenzenecarboximidothioate (PubChem CID 146292458) has the molecular formula C24H30N6S and a molecular weight of 434.61 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-cyano-4-pyridin-3-ylbenzenecarboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-cyano-4-pyridin-3-ylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 146292458 |
| Molecular Formula | C24H30N6S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-cyano-4-pyridin-3-ylbenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(-c2cccnc2)cc1C#N)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H30N6S/c1-23(2)12-19(13-24(3,4)29-23)30(5)22(27)31-21(26)20-9-8-16(11-18(20)14-25)17-7-6-10-28-15-17/h6-11,15,19,26-27,29H,12-13H2,1-5H3/b26-21+,27-22- |
| InChIKey | VDLLPVQDVKFHEQ-MQQISXSPSA-N |
| XLogP | 4.85 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|