C21H31N7OS — CID 146292410
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-(3-aminopyrazol-1-yl)-2-hydroxybenzenecarboximidothioate (PubChem CID 146292410) has the molecular formula C21H31N7OS and a molecular weight of 429.59 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-(3-aminopyrazol-1-yl)-2-hydroxybenzenecarboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-(3-aminopyrazol-1-yl)-2-hydroxybenzenecarboximidothioate |
|---|---|
| PubChem CID | 146292410 |
| Molecular Formula | C21H31N7OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-(3-aminopyrazol-1-yl)-2-hydroxybenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(-n2ccc(N)n2)cc1O)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H31N7OS/c1-20(2)11-14(12-21(3,4)26-20)27(5)19(24)30-18(23)15-7-6-13(10-16(15)29)28-9-8-17(22)25-28/h6-10,14,23-24,26,29H,11-12H2,1-5H3,(H2,22,25)/b23-18+,24-19- |
| InChIKey | ZIMMXKXMNMVUGO-JGYBJGQYSA-N |
| XLogP | 3.39 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|