C21H29N7OS — CID 146292419
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-nitroso-4-pyrazol-1-ylbenzenecarboximidothioate (PubChem CID 146292419) has the molecular formula C21H29N7OS and a molecular weight of 427.58 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-nitroso-4-pyrazol-1-ylbenzenecarboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-nitroso-4-pyrazol-1-ylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 146292419 |
| Molecular Formula | C21H29N7OS |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-nitroso-4-pyrazol-1-ylbenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(-n2cccn2)cc1N=O)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H29N7OS/c1-20(2)12-15(13-21(3,4)26-20)27(5)19(23)30-18(22)16-8-7-14(11-17(16)25-29)28-10-6-9-24-28/h6-11,15,22-23,26H,12-13H2,1-5H3/b22-18+,23-19- |
| InChIKey | PGNNOEYEUDCABL-YLRGQORSSA-N |
| XLogP | 4.50 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|