C19H26FN5S — CID 144674686
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-cyano-2-fluorobenzenecarboximidothioate (PubChem CID 144674686) has the molecular formula C19H26FN5S and a molecular weight of 375.52 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-cyano-2-fluorobenzenecarboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-cyano-2-fluorobenzenecarboximidothioate |
|---|---|
| PubChem CID | 144674686 |
| Molecular Formula | C19H26FN5S |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-cyano-2-fluorobenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(C#N)cc1F)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C19H26FN5S/c1-18(2)9-13(10-19(3,4)24-18)25(5)17(23)26-16(22)14-7-6-12(11-21)8-15(14)20/h6-8,13,22-24H,9-10H2,1-5H3/b22-16+,23-17- |
| InChIKey | ZWTSSNQYRNPHSG-VLKJOQIWSA-N |
| XLogP | 3.93 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|