C32H49N5O4 — CID 146238311
tert-butyl N-[3-[6-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-7-hydroxynaphthalen-2-yl]oxypropyl]carbamate (PubChem CID 146238311) has the molecular formula C32H49N5O4 and a molecular weight of 567.78 g/mol. Its IUPAC name is tert-butyl N-[3-[6-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-7-hydroxynaphthalen-2-yl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[6-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-7-hydroxynaphthalen-2-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 146238311 |
| Molecular Formula | C32H49N5O4 |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.38 |
| IUPAC Name | tert-butyl N-[3-[6-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]-7-hydroxynaphthalen-2-yl]oxypropyl]carbamate |
| SMILES | CN(/C(N)=C/C=C(\N)c1cc2ccc(OCCCNC(=O)OC(C)(C)C)cc2cc1O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C32H49N5O4/c1-30(2,3)41-29(39)35-14-9-15-40-24-11-10-21-17-25(27(38)18-22(21)16-24)26(33)12-13-28(34)37(8)23-19-31(4,5)36-32(6,7)20-23/h10-13,16-18,23,36,38H,9,14-15,19-20,33-34H2,1-8H3,(H,35,39)/b26-12-,28-13+ |
| InChIKey | HPIJYZCXDUXYOM-NQIFHAGWSA-N |
| XLogP | 5.18 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|