C38H46B2N3O5 — CID 153385010
CID 153385010 (PubChem CID 153385010) has the molecular formula C38H46B2N3O5 and a molecular weight of 646.43 g/mol.
| Compound Name | CID 153385010 |
|---|---|
| PubChem CID | 153385010 |
| Molecular Formula | C38H46B2N3O5 |
| Molecular Weight | 646.43 g/mol |
| Exact Mass | 646.36 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)NCCCN(Cc1ccc(CN(Cc2ccc(OCC)cc2)Cc2ccccc2[B]O)cc1)Cc1ccccc1B(O)O |
| InChI | InChI=1S/C38H46B2N3O5/c1-4-48-35-20-18-32(19-21-35)26-43(27-33-10-5-7-12-36(33)39-45)25-31-16-14-30(15-17-31)24-42(23-9-22-41-38(44)29(2)3)28-34-11-6-8-13-37(34)40(46)47/h5-8,10-21,45-47H,2,4,9,22-28H2,1,3H3,(H,41,44) |
| InChIKey | CELHYTDYGCWOED-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|