C14H21BN2O3 — CID 25052261
[2-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]phenyl]boronic acid (PubChem CID 25052261) has the molecular formula C14H21BN2O3 and a molecular weight of 276.15 g/mol. Its IUPAC name is [2-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]phenyl]boronic acid.
| Compound Name | [2-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 25052261 |
| Molecular Formula | C14H21BN2O3 |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [2-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]phenyl]boronic acid |
| SMILES | C=C(C)C(=O)NCCCNCc1ccccc1B(O)O |
| InChI | InChI=1S/C14H21BN2O3/c1-11(2)14(18)17-9-5-8-16-10-12-6-3-4-7-13(12)15(19)20/h3-4,6-7,16,19-20H,1,5,8-10H2,2H3,(H,17,18) |
| InChIKey | URDPQVVNVMCDDC-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|