C15H24BN3O3 — CID 163431518
[2-[[methylamino-[3-(2-methylprop-2-enoylamino)propyl]amino]methyl]phenyl]boronic acid (PubChem CID 163431518) has the molecular formula C15H24BN3O3 and a molecular weight of 305.19 g/mol. Its IUPAC name is [2-[[methylamino-[3-(2-methylprop-2-enoylamino)propyl]amino]methyl]phenyl]boronic acid.
| Compound Name | [2-[[methylamino-[3-(2-methylprop-2-enoylamino)propyl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 163431518 |
| Molecular Formula | C15H24BN3O3 |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | [2-[[methylamino-[3-(2-methylprop-2-enoylamino)propyl]amino]methyl]phenyl]boronic acid |
| SMILES | C=C(C)C(=O)NCCCN(Cc1ccccc1B(O)O)NC |
| InChI | InChI=1S/C15H24BN3O3/c1-12(2)15(20)18-9-6-10-19(17-3)11-13-7-4-5-8-14(13)16(21)22/h4-5,7-8,17,21-22H,1,6,9-11H2,2-3H3,(H,18,20) |
| InChIKey | AQWLCDBQMRSXBY-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|