C26H34F3NO4Si — CID 15338634
benzyl (2S,4S,5S)-4-benzyl-2-tert-butyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate (PubChem CID 15338634) has the molecular formula C26H34F3NO4Si and a molecular weight of 509.64 g/mol. Its IUPAC name is benzyl (2S,4S,5S)-4-benzyl-2-tert-butyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (2S,4S,5S)-4-benzyl-2-tert-butyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15338634 |
| Molecular Formula | C26H34F3NO4Si |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | benzyl (2S,4S,5S)-4-benzyl-2-tert-butyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)[C@@H]1O[C@@](O[Si](C)(C)C)(C(F)(F)F)[C@H](Cc2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H34F3NO4Si/c1-24(2,3)22-30(23(31)32-18-20-15-11-8-12-16-20)21(17-19-13-9-7-10-14-19)25(33-22,26(27,28)29)34-35(4,5)6/h7-16,21-22H,17-18H2,1-6H3/t21-,22-,25-/m0/s1 |
| InChIKey | WBJLDPLBWCGOKG-HWBMXIPRSA-N |
| XLogP | 6.75 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|