C21H24N4O6P2 — CID 153388956
[2-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-4-dihydroxyphosphanyloxyphenyl] dihydrogen phosphite (PubChem CID 153388956) has the molecular formula C21H24N4O6P2 and a molecular weight of 490.39 g/mol. Its IUPAC name is [2-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-4-dihydroxyphosphanyloxyphenyl] dihydrogen phosphite.
| Compound Name | [2-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-4-dihydroxyphosphanyloxyphenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 153388956 |
| Molecular Formula | C21H24N4O6P2 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [2-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-4-dihydroxyphosphanyloxyphenyl] dihydrogen phosphite |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1Cc1cc(OP(O)O)ccc1OP(O)O |
| InChI | InChI=1S/C21H24N4O6P2/c1-2-3-8-18-24-19-20(15-6-4-5-7-16(15)23-21(19)22)25(18)12-13-11-14(30-32(26)27)9-10-17(13)31-33(28)29/h4-7,9-11,26-29H,2-3,8,12H2,1H3,(H2,22,23) |
| InChIKey | JFUCXFMPZMZKLC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 156.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|