About ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide
ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide (PubChem CID 153389365) has the molecular formula C11H26N2
and a molecular weight of 186.34 g/mol. Its IUPAC name is ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide.
Molecular Properties
| Compound Name | ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide |
| PubChem CID | 153389365 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide |
| SMILES | C/C=C\N=C(/N)C(C)C.CC.CC |
| InChI | InChI=1S/C7H14N2.2C2H6/c1-4-5-9-7(8)6(2)3;2*1-2/h4-6H,1-3H3,(H2,8,9);2*1-2H3/b5-4-;; |
| InChIKey | FGKLFCIYOPIXKG-WNCVTPEDSA-N |
| XLogP | 3.59 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide?
The IUPAC name of ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide (CID 153389365) is ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide.
What is the SMILES notation for ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide?
The canonical SMILES for ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide is C/C=C\N=C(/N)C(C)C.CC.CC.
What is the InChIKey of ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide?
The InChIKey is FGKLFCIYOPIXKG-WNCVTPEDSA-N. The full InChI is InChI=1S/C7H14N2.2C2H6/c1-4-5-9-7(8)6(2)3;2*1-2/h4-6H,1-3H3,(H2,8,9);2*1-2H3/b5-4-;;.
What are the key properties of ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide?
ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide has a molecular weight of 186.34 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-N'-[(Z)-prop-1-enyl]propanimidamide is sourced from PubChem (CID 153389365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).