C15H22F2O2 — CID 153389602
2-[4-(difluoromethoxy)-2,6-dipropylcyclohexa-2,4-dien-1-yl]acetaldehyde (PubChem CID 153389602) has the molecular formula C15H22F2O2 and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)-2,6-dipropylcyclohexa-2,4-dien-1-yl]acetaldehyde.
| Compound Name | 2-[4-(difluoromethoxy)-2,6-dipropylcyclohexa-2,4-dien-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 153389602 |
| Molecular Formula | C15H22F2O2 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[4-(difluoromethoxy)-2,6-dipropylcyclohexa-2,4-dien-1-yl]acetaldehyde |
| SMILES | CCCC1=CC(OC(F)F)=CC(CCC)C1CC=O |
| InChI | InChI=1S/C15H22F2O2/c1-3-5-11-9-13(19-15(16)17)10-12(6-4-2)14(11)7-8-18/h8-11,14-15H,3-7H2,1-2H3 |
| InChIKey | YSMWQCVRQPNLBQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|