C23H32F2O2 — CID 143909499
(7Z,11Z)-13-butoxy-7,8-difluoro-2,5-dimethyl-6,9,10-trimethylidenetetradeca-7,11,13-trienal (PubChem CID 143909499) has the molecular formula C23H32F2O2 and a molecular weight of 378.50 g/mol. Its IUPAC name is (7Z,11Z)-13-butoxy-7,8-difluoro-2,5-dimethyl-6,9,10-trimethylidenetetradeca-7,11,13-trienal.
| Compound Name | (7Z,11Z)-13-butoxy-7,8-difluoro-2,5-dimethyl-6,9,10-trimethylidenetetradeca-7,11,13-trienal |
|---|---|
| PubChem CID | 143909499 |
| Molecular Formula | C23H32F2O2 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (7Z,11Z)-13-butoxy-7,8-difluoro-2,5-dimethyl-6,9,10-trimethylidenetetradeca-7,11,13-trienal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C(C)CCC(C)C=O)OCCCC |
| InChI | InChI=1S/C23H32F2O2/c1-8-9-14-27-19(5)13-12-18(4)21(7)23(25)22(24)20(6)17(3)11-10-16(2)15-26/h12-13,15-17H,4-11,14H2,1-3H3/b13-12-,23-22- |
| InChIKey | LSQFWRDQIFXIIM-PBVGCSHXSA-N |
| XLogP | 6.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|