C28H38O2 — CID 123406867
3-(12-ethyl-11-methoxy-6,16-dimethylcycloicosa-3,5,7,9,11,14,16,18-octaen-1-yl)propanal (PubChem CID 123406867) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is 3-(12-ethyl-11-methoxy-6,16-dimethylcycloicosa-3,5,7,9,11,14,16,18-octaen-1-yl)propanal.
| Compound Name | 3-(12-ethyl-11-methoxy-6,16-dimethylcycloicosa-3,5,7,9,11,14,16,18-octaen-1-yl)propanal |
|---|---|
| PubChem CID | 123406867 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 3-(12-ethyl-11-methoxy-6,16-dimethylcycloicosa-3,5,7,9,11,14,16,18-octaen-1-yl)propanal |
| SMILES | CCC1=C(OC)C=CC=CC(C)=CC=CCC(CCC=O)CC=CC=C(C)C=CC1 |
| InChI | InChI=1S/C28H38O2/c1-5-27-21-12-17-25(3)15-7-10-19-26(20-13-23-29)18-9-6-14-24(2)16-8-11-22-28(27)30-4/h6-12,14-17,22-23,26H,5,13,18-21H2,1-4H3 |
| InChIKey | FJRQIIRKNLCOBB-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|