C14H22O2 — CID 90689919
3-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]pentan-2-one (PubChem CID 90689919) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]pentan-2-one.
| Compound Name | 3-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]pentan-2-one |
|---|---|
| PubChem CID | 90689919 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 3-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]pentan-2-one |
| SMILES | CCOC1=CCC(CC(CC)C(C)=O)C=C1 |
| InChI | InChI=1S/C14H22O2/c1-4-13(11(3)15)10-12-6-8-14(9-7-12)16-5-2/h6,8-9,12-13H,4-5,7,10H2,1-3H3 |
| InChIKey | WSIOKYIZPOLFSR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |