C23H28FN3O2S — CID 153389667
N-[4-[[(Z)-3-aminoprop-2-enylidene]amino]phenyl]sulfinyl-2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 153389667) has the molecular formula C23H28FN3O2S and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[4-[[(Z)-3-aminoprop-2-enylidene]amino]phenyl]sulfinyl-2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | N-[4-[[(Z)-3-aminoprop-2-enylidene]amino]phenyl]sulfinyl-2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 153389667 |
| Molecular Formula | C23H28FN3O2S |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[4-[[(Z)-3-aminoprop-2-enylidene]amino]phenyl]sulfinyl-2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1cc(F)cc(C(C)C)c1CC(=O)NS(=O)c1ccc(/N=C/C=C\N)cc1 |
| InChI | InChI=1S/C23H28FN3O2S/c1-15(2)20-12-17(24)13-21(16(3)4)22(20)14-23(28)27-30(29)19-8-6-18(7-9-19)26-11-5-10-25/h5-13,15-16H,14,25H2,1-4H3,(H,27,28)/b10-5-,26-11+ |
| InChIKey | TXHSLERVUDQHCI-LGRYXQGFSA-N |
| XLogP | 4.63 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|