About (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene
(5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene (PubChem CID 153389792) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene.
Molecular Properties
| Compound Name | (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene |
| PubChem CID | 153389792 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene |
| SMILES | CC1=CC(C2(C)CC2)=C[C@@H]1C |
| InChI | InChI=1S/C11H16/c1-8-6-10(7-9(8)2)11(3)4-5-11/h6-8H,4-5H2,1-3H3/t8-/m0/s1 |
| InChIKey | KXYXUGSIFALSHR-QMMMGPOBSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene?
The IUPAC name of (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene (CID 153389792) is (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene.
What is the SMILES notation for (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene?
The canonical SMILES for (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene is CC1=CC(C2(C)CC2)=C[C@@H]1C.
What is the InChIKey of (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene?
The InChIKey is KXYXUGSIFALSHR-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H16/c1-8-6-10(7-9(8)2)11(3)4-5-11/h6-8H,4-5H2,1-3H3/t8-/m0/s1.
What are the key properties of (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene?
(5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene has a molecular weight of 148.25 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1,5-dimethyl-3-(1-methylcyclopropyl)cyclopenta-1,3-diene is sourced from PubChem (CID 153389792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).