C39H41N9O3 — CID 153390746
3-[6-[5-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]pentyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione (PubChem CID 153390746) has the molecular formula C39H41N9O3 and a molecular weight of 683.82 g/mol. Its IUPAC name is 3-[6-[5-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]pentyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]pentyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 153390746 |
| Molecular Formula | C39H41N9O3 |
| Molecular Weight | 683.82 g/mol |
| Exact Mass | 683.33 |
| IUPAC Name | 3-[6-[5-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]pentyl]pyrido[2,3-b]indol-9-yl]piperidine-2,6-dione |
| SMILES | Nc1nnc(-c2ccccc2O)cc1-c1cnn(C2CCN(CCCCCc3ccc4c(c3)c3cccnc3n4C3CCC(=O)NC3=O)CC2)c1 |
| InChI | InChI=1S/C39H41N9O3/c40-37-30(22-32(44-45-37)29-8-3-4-10-35(29)49)26-23-42-47(24-26)27-15-19-46(20-16-27)18-5-1-2-7-25-11-12-33-31(21-25)28-9-6-17-41-38(28)48(33)34-13-14-36(50)43-39(34)51/h3-4,6,8-12,17,21-24,27,34,49H,1-2,5,7,13-16,18-20H2,(H2,40,45)(H,43,50,51) |
| InChIKey | NNMJJWIXWPONCU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 157.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.82 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|