C39H40N8O3 — CID 167418061
3-[3-[4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]butyl]carbazol-9-yl]piperidine-2,6-dione (PubChem CID 167418061) has the molecular formula C39H40N8O3 and a molecular weight of 668.80 g/mol. Its IUPAC name is 3-[3-[4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]butyl]carbazol-9-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]butyl]carbazol-9-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167418061 |
| Molecular Formula | C39H40N8O3 |
| Molecular Weight | 668.80 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | 3-[3-[4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]butyl]carbazol-9-yl]piperidine-2,6-dione |
| SMILES | Nc1nnc(-c2ccccc2O)cc1-c1cnn(C2CCN(CCCCc3ccc4c(c3)c3ccccc3n4C3CCC(=O)NC3=O)CC2)c1 |
| InChI | InChI=1S/C39H40N8O3/c40-38-30(22-32(43-44-38)29-9-2-4-11-36(29)48)26-23-41-46(24-26)27-16-19-45(20-17-27)18-6-5-7-25-12-13-34-31(21-25)28-8-1-3-10-33(28)47(34)35-14-15-37(49)42-39(35)50/h1-4,8-13,21-24,27,35,48H,5-7,14-20H2,(H2,40,44)(H,42,49,50) |
| InChIKey | NDUNVFPBBWTKAC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.80 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|