C30H39N7O2 — CID 155740707
2-[4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]phenyl]acetamide;ethane (PubChem CID 155740707) has the molecular formula C30H39N7O2 and a molecular weight of 529.69 g/mol. Its IUPAC name is 2-[4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]phenyl]acetamide;ethane.
| Compound Name | 2-[4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]phenyl]acetamide;ethane |
|---|---|
| PubChem CID | 155740707 |
| Molecular Formula | C30H39N7O2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | 2-[4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]phenyl]acetamide;ethane |
| SMILES | CC.CC.NC(=O)Cc1ccc(N2CCC(n3cc(-c4cc(-c5ccccc5O)nnc4N)cn3)CC2)cc1 |
| InChI | InChI=1S/C26H27N7O2.2C2H6/c27-25(35)13-17-5-7-19(8-6-17)32-11-9-20(10-12-32)33-16-18(15-29-33)22-14-23(30-31-26(22)28)21-3-1-2-4-24(21)34;2*1-2/h1-8,14-16,20,34H,9-13H2,(H2,27,35)(H2,28,31);2*1-2H3 |
| InChIKey | SYZPWLPOUQAJQK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|