C38H45N9O4 — CID 155405436
3-[4-[7-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]heptyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 155405436) has the molecular formula C38H45N9O4 and a molecular weight of 691.84 g/mol. Its IUPAC name is 3-[4-[7-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]heptyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[7-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]heptyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155405436 |
| Molecular Formula | C38H45N9O4 |
| Molecular Weight | 691.84 g/mol |
| Exact Mass | 691.36 |
| IUPAC Name | 3-[4-[7-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]piperidin-1-yl]heptyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCCCCCN3CCC(n4cc(-c5cc(-c6ccccc6O)nnc5N)cn4)CC3)c21 |
| InChI | InChI=1S/C38H45N9O4/c1-44-35-25(11-9-13-31(35)47(38(44)51)32-15-16-34(49)41-37(32)50)10-5-3-2-4-8-19-45-20-17-27(18-21-45)46-24-26(23-40-46)29-22-30(42-43-36(29)39)28-12-6-7-14-33(28)48/h6-7,9,11-14,22-24,27,32,48H,2-5,8,10,15-21H2,1H3,(H2,39,43)(H,41,49,50) |
| InChIKey | AYFPLYPHCRTJIF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 166.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|