C40H46N8O5 — CID 167386711
3-[4-[6-[3-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]hexyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 167386711) has the molecular formula C40H46N8O5 and a molecular weight of 718.86 g/mol. Its IUPAC name is 3-[4-[6-[3-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]hexyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[6-[3-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]hexyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167386711 |
| Molecular Formula | C40H46N8O5 |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.36 |
| IUPAC Name | 3-[4-[6-[3-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]hexyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCCCCOc3cccc(CN4CCN(c5cc(-c6ccccc6O)nnc5N)CC4)c3)c21 |
| InChI | InChI=1S/C40H46N8O5/c1-45-37-28(12-9-15-32(37)48(40(45)52)33-17-18-36(50)42-39(33)51)11-4-2-3-7-23-53-29-13-8-10-27(24-29)26-46-19-21-47(22-20-46)34-25-31(43-44-38(34)41)30-14-5-6-16-35(30)49/h5-6,8-10,12-16,24-25,33,49H,2-4,7,11,17-23,26H2,1H3,(H2,41,44)(H,42,50,51) |
| InChIKey | CYHWYAPDIRLBKN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 160.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|