C35H44N8O4 — CID 167386888
3-[4-[8-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]octyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 167386888) has the molecular formula C35H44N8O4 and a molecular weight of 640.79 g/mol. Its IUPAC name is 3-[4-[8-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]octyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[8-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]octyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167386888 |
| Molecular Formula | C35H44N8O4 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | 3-[4-[8-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]octyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(CCCCCCCCN3CCN(c4cc(-c5ccccc5O)nnc4N)CC3)c21 |
| InChI | InChI=1S/C35H44N8O4/c1-40-32-24(12-10-14-27(32)43(35(40)47)28-16-17-31(45)37-34(28)46)11-6-4-2-3-5-9-18-41-19-21-42(22-20-41)29-23-26(38-39-33(29)36)25-13-7-8-15-30(25)44/h7-8,10,12-15,23,28,44H,2-6,9,11,16-22H2,1H3,(H2,36,39)(H,37,45,46) |
| InChIKey | LOOARMAZTXVHJL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|