C38H42N8O5 — CID 155405358
3-[5-[4-[3-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]butyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 155405358) has the molecular formula C38H42N8O5 and a molecular weight of 690.81 g/mol. Its IUPAC name is 3-[5-[4-[3-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]butyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-[3-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]butyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155405358 |
| Molecular Formula | C38H42N8O5 |
| Molecular Weight | 690.81 g/mol |
| Exact Mass | 690.33 |
| IUPAC Name | 3-[5-[4-[3-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]butyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(CCCCOc3cccc(CN4CCN(c5cc(-c6ccccc6O)nnc5N)CC4)c3)cc21 |
| InChI | InChI=1S/C38H42N8O5/c1-43-32-22-25(12-13-30(32)46(38(43)50)31-14-15-35(48)40-37(31)49)7-4-5-20-51-27-9-6-8-26(21-27)24-44-16-18-45(19-17-44)33-23-29(41-42-36(33)39)28-10-2-3-11-34(28)47/h2-3,6,8-13,21-23,31,47H,4-5,7,14-20,24H2,1H3,(H2,39,42)(H,40,48,49) |
| InChIKey | ITTCWWFYNKLKBM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 160.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|