C41H48N8O5 — CID 155405150
3-[5-[7-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]heptyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 155405150) has the molecular formula C41H48N8O5 and a molecular weight of 732.89 g/mol. Its IUPAC name is 3-[5-[7-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]heptyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[7-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]heptyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155405150 |
| Molecular Formula | C41H48N8O5 |
| Molecular Weight | 732.89 g/mol |
| Exact Mass | 732.37 |
| IUPAC Name | 3-[5-[7-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]phenoxy]heptyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(CCCCCCCOc3ccc(CN4CCN(c5cc(-c6ccccc6O)nnc5N)CC4)cc3)cc21 |
| InChI | InChI=1S/C41H48N8O5/c1-46-35-25-28(14-17-33(35)49(41(46)53)34-18-19-38(51)43-40(34)52)9-5-3-2-4-8-24-54-30-15-12-29(13-16-30)27-47-20-22-48(23-21-47)36-26-32(44-45-39(36)42)31-10-6-7-11-37(31)50/h6-7,10-17,25-26,34,50H,2-5,8-9,18-24,27H2,1H3,(H2,42,45)(H,43,51,52) |
| InChIKey | PEXXMSVLPUBMMP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 160.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|