C30H43N9O5S — CID 153391010
N-[3-[(E)-4-[2-amino-6-(3-methoxypropoxy)-4-methylanilino]but-2-enyl]-5-formylthieno[2,3-d]imidazol-2-yl]-2-ethyl-5-methylpyrazole-3-carboxamide;formamide;methanamine (PubChem CID 153391010) has the molecular formula C30H43N9O5S and a molecular weight of 641.80 g/mol. Its IUPAC name is N-[3-[(E)-4-[2-amino-6-(3-methoxypropoxy)-4-methylanilino]but-2-enyl]-5-formylthieno[2,3-d]imidazol-2-yl]-2-ethyl-5-methylpyrazole-3-carboxamide;formamide;methanamine.
| Compound Name | N-[3-[(E)-4-[2-amino-6-(3-methoxypropoxy)-4-methylanilino]but-2-enyl]-5-formylthieno[2,3-d]imidazol-2-yl]-2-ethyl-5-methylpyrazole-3-carboxamide;formamide;methanamine |
|---|---|
| PubChem CID | 153391010 |
| Molecular Formula | C30H43N9O5S |
| Molecular Weight | 641.80 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | N-[3-[(E)-4-[2-amino-6-(3-methoxypropoxy)-4-methylanilino]but-2-enyl]-5-formylthieno[2,3-d]imidazol-2-yl]-2-ethyl-5-methylpyrazole-3-carboxamide;formamide;methanamine |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C=O)sc2n1C/C=C/CNc1c(N)cc(C)cc1OCCCOC.CN.NC=O |
| InChI | InChI=1S/C28H35N7O4S.CH3NO.CH5N/c1-5-35-23(15-19(3)33-35)26(37)32-28-31-22-16-20(17-36)40-27(22)34(28)10-7-6-9-30-25-21(29)13-18(2)14-24(25)39-12-8-11-38-4;2-1-3;1-2/h6-7,13-17,30H,5,8-12,29H2,1-4H3,(H,31,32,37);1H,(H2,2,3);2H2,1H3/b7-6+;; |
| InChIKey | SHXJBZZRAAMARC-KMXZHCNGSA-N |
| XLogP | 3.34 |
| TPSA | 207.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.80 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|