About potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine
potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine (PubChem CID 153392267) has the molecular formula C9H13KN2
and a molecular weight of 188.31 g/mol. Its IUPAC name is potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine.
Molecular Properties
| Compound Name | potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine |
| PubChem CID | 153392267 |
| Molecular Formula | C9H13KN2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine |
| SMILES | C=Cc1[c-]ccnc1N.CC.[K+] |
| InChI | InChI=1S/C7H7N2.C2H6.K/c1-2-6-4-3-5-9-7(6)8;1-2;/h2-3,5H,1H2,(H2,8,9);1-2H3;/q-1;;+1 |
| InChIKey | KACNQZWVEJOIHX-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine?
The IUPAC name of potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine (CID 153392267) is potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine.
What is the SMILES notation for potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine?
The canonical SMILES for potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine is C=Cc1[c-]ccnc1N.CC.[K+].
What is the InChIKey of potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine?
The InChIKey is KACNQZWVEJOIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2.C2H6.K/c1-2-6-4-3-5-9-7(6)8;1-2;/h2-3,5H,1H2,(H2,8,9);1-2H3;/q-1;;+1.
What are the key properties of potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine?
potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine has a molecular weight of 188.31 g/mol, XLogP of -0.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethane;3-ethenyl-4H-pyridin-4-id-2-amine is sourced from PubChem (CID 153392267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).