C10H12N2 — CID 129060105
(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridin-2-amine (PubChem CID 129060105) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridin-2-amine.
| Compound Name | (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridin-2-amine |
|---|---|
| PubChem CID | 129060105 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridin-2-amine |
| SMILES | C=C/C=c1/c(N)ncc/c1=C/C |
| InChI | InChI=1S/C10H12N2/c1-3-5-9-8(4-2)6-7-12-10(9)11/h3-7H,1H2,2H3,(H2,11,12)/b8-4-,9-5+ |
| InChIKey | DJUZKWLSJPXOGS-MVTUOISNSA-N |
| XLogP | 0.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |