C14H9Br2O2P — CID 15339363
2,6-dibromo-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide (PubChem CID 15339363) has the molecular formula C14H9Br2O2P and a molecular weight of 400.01 g/mol. Its IUPAC name is 2,6-dibromo-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide.
| Compound Name | 2,6-dibromo-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide |
|---|---|
| PubChem CID | 15339363 |
| Molecular Formula | C14H9Br2O2P |
| Molecular Weight | 400.01 g/mol |
| Exact Mass | 397.87 |
| IUPAC Name | 2,6-dibromo-4-phenyl-1,2λ5-benzoxaphosphinine 2-oxide |
| SMILES | O=P1(Br)C=C(c2ccccc2)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C14H9Br2O2P/c15-11-6-7-14-12(8-11)13(9-19(16,17)18-14)10-4-2-1-3-5-10/h1-9H |
| InChIKey | ULNPRLJAESJXSX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.01 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|