C22H22N4 — CID 153394318
(Z)-N-methyl-2-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]pent-2-en-1-imine (PubChem CID 153394318) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is (Z)-N-methyl-2-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]pent-2-en-1-imine.
| Compound Name | (Z)-N-methyl-2-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]pent-2-en-1-imine |
|---|---|
| PubChem CID | 153394318 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (Z)-N-methyl-2-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]pent-2-en-1-imine |
| SMILES | CC/C=C(\C=N\C)c1cccc(-c2nc(C)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H22N4/c1-4-9-20(15-23-3)18-12-8-13-19(14-18)22-25-16(2)24-21(26-22)17-10-6-5-7-11-17/h5-15H,4H2,1-3H3/b20-9+,23-15+ |
| InChIKey | QSRNRVCZXPAJPP-YMIUVCBXSA-N |
| XLogP | 5.01 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|