C46H34N4 — CID 153394371
2,4-diphenyl-6-[3-(10-phenyl-3,4,5,6-tetrahydrophenanthren-9-yl)-5-pyridin-4-ylphenyl]-1,3,5-triazine (PubChem CID 153394371) has the molecular formula C46H34N4 and a molecular weight of 642.81 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-(10-phenyl-3,4,5,6-tetrahydrophenanthren-9-yl)-5-pyridin-4-ylphenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[3-(10-phenyl-3,4,5,6-tetrahydrophenanthren-9-yl)-5-pyridin-4-ylphenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 153394371 |
| Molecular Formula | C46H34N4 |
| Molecular Weight | 642.81 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2,4-diphenyl-6-[3-(10-phenyl-3,4,5,6-tetrahydrophenanthren-9-yl)-5-pyridin-4-ylphenyl]-1,3,5-triazine |
| SMILES | C1=Cc2c(c3c(c(-c4cc(-c5ccncc5)cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c2-c2ccccc2)C=CCC3)CC1 |
| InChI | InChI=1S/C46H34N4/c1-4-14-32(15-5-1)42-40-22-12-10-20-38(40)39-21-11-13-23-41(39)43(42)36-28-35(31-24-26-47-27-25-31)29-37(30-36)46-49-44(33-16-6-2-7-17-33)48-45(50-46)34-18-8-3-9-19-34/h1-9,12-19,22-30H,10-11,20-21H2 |
| InChIKey | BSHNCRDAKHMXOH-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.81 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |