C12H23N — CID 15339509
(Z)-2,2,6,6-tetramethyl-5-methylidenehept-3-en-3-amine (PubChem CID 15339509) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (Z)-2,2,6,6-tetramethyl-5-methylidenehept-3-en-3-amine.
| Compound Name | (Z)-2,2,6,6-tetramethyl-5-methylidenehept-3-en-3-amine |
|---|---|
| PubChem CID | 15339509 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (Z)-2,2,6,6-tetramethyl-5-methylidenehept-3-en-3-amine |
| SMILES | C=C(/C=C(\N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H23N/c1-9(11(2,3)4)8-10(13)12(5,6)7/h8H,1,13H2,2-7H3/b10-8- |
| InChIKey | FVIYLMLHZNYGNW-NTMALXAHSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|