C20H34O4 — CID 153400987
1-ethyl-3,5-dimethoxybenzene;2-methylpentan-3-yl butanoate (PubChem CID 153400987) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethoxybenzene;2-methylpentan-3-yl butanoate.
| Compound Name | 1-ethyl-3,5-dimethoxybenzene;2-methylpentan-3-yl butanoate |
|---|---|
| PubChem CID | 153400987 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-ethyl-3,5-dimethoxybenzene;2-methylpentan-3-yl butanoate |
| SMILES | CCCC(=O)OC(CC)C(C)C.CCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C10H14O2.C10H20O2/c1-4-8-5-9(11-2)7-10(6-8)12-3;1-5-7-10(11)12-9(6-2)8(3)4/h5-7H,4H2,1-3H3;8-9H,5-7H2,1-4H3 |
| InChIKey | ANSXUDLSRDNAHV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |