C41H37O5P — CID 153401583
3-[[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]-triphenyl-λ5-phosphanyl]propanoic acid (PubChem CID 153401583) has the molecular formula C41H37O5P and a molecular weight of 640.72 g/mol. Its IUPAC name is 3-[[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]-triphenyl-λ5-phosphanyl]propanoic acid.
| Compound Name | 3-[[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]-triphenyl-λ5-phosphanyl]propanoic acid |
|---|---|
| PubChem CID | 153401583 |
| Molecular Formula | C41H37O5P |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 3-[[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]-triphenyl-λ5-phosphanyl]propanoic acid |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(OP(CCC(=O)O)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H37O5P/c1-41(31-17-23-34(42)24-18-31,32-19-25-35(43)26-20-32)33-21-27-36(28-22-33)46-47(30-29-40(44)45,37-11-5-2-6-12-37,38-13-7-3-8-14-38)39-15-9-4-10-16-39/h2-28,42-43H,29-30H2,1H3,(H,44,45) |
| InChIKey | YCXXZGYKZGMAAH-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|