C47H45O10P — CID 153401413
3-[[4-[[4-[bis(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxyphenyl)methyl]phenoxy]-bis(2-carboxyethyl)-phenyl-λ5-phosphanyl]propanoic acid (PubChem CID 153401413) has the molecular formula C47H45O10P and a molecular weight of 800.84 g/mol. Its IUPAC name is 3-[[4-[[4-[bis(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxyphenyl)methyl]phenoxy]-bis(2-carboxyethyl)-phenyl-λ5-phosphanyl]propanoic acid.
| Compound Name | 3-[[4-[[4-[bis(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxyphenyl)methyl]phenoxy]-bis(2-carboxyethyl)-phenyl-λ5-phosphanyl]propanoic acid |
|---|---|
| PubChem CID | 153401413 |
| Molecular Formula | C47H45O10P |
| Molecular Weight | 800.84 g/mol |
| Exact Mass | 800.28 |
| IUPAC Name | 3-[[4-[[4-[bis(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxyphenyl)methyl]phenoxy]-bis(2-carboxyethyl)-phenyl-λ5-phosphanyl]propanoic acid |
| SMILES | O=C(O)CCP(CCC(=O)O)(CCC(=O)O)(Oc1ccc(C(c2ccc(O)cc2)c2ccc(C(c3ccc(O)cc3)c3ccc(O)cc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C47H45O10P/c48-38-18-10-34(11-19-38)46(35-12-20-39(49)21-13-35)32-6-8-33(9-7-32)47(36-14-22-40(50)23-15-36)37-16-24-41(25-17-37)57-58(29-26-43(51)52,30-27-44(53)54,31-28-45(55)56)42-4-2-1-3-5-42/h1-25,46-50H,26-31H2,(H,51,52)(H,53,54)(H,55,56) |
| InChIKey | XZZDGCODZNGGTR-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.84 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|