C59H51O4P — CID 153401513
4-[(4-hydroxyphenyl)-[4-[(4-hydroxyphenyl)-[4-[tris(4-methylphenyl)-phenyl-λ5-phosphanyl]oxyphenyl]methyl]phenyl]methyl]phenol (PubChem CID 153401513) has the molecular formula C59H51O4P and a molecular weight of 855.03 g/mol. Its IUPAC name is 4-[(4-hydroxyphenyl)-[4-[(4-hydroxyphenyl)-[4-[tris(4-methylphenyl)-phenyl-λ5-phosphanyl]oxyphenyl]methyl]phenyl]methyl]phenol.
| Compound Name | 4-[(4-hydroxyphenyl)-[4-[(4-hydroxyphenyl)-[4-[tris(4-methylphenyl)-phenyl-λ5-phosphanyl]oxyphenyl]methyl]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 153401513 |
| Molecular Formula | C59H51O4P |
| Molecular Weight | 855.03 g/mol |
| Exact Mass | 854.35 |
| IUPAC Name | 4-[(4-hydroxyphenyl)-[4-[(4-hydroxyphenyl)-[4-[tris(4-methylphenyl)-phenyl-λ5-phosphanyl]oxyphenyl]methyl]phenyl]methyl]phenol |
| SMILES | Cc1ccc(P(Oc2ccc(C(c3ccc(O)cc3)c3ccc(C(c4ccc(O)cc4)c4ccc(O)cc4)cc3)cc2)(c2ccccc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C59H51O4P/c1-41-9-35-55(36-10-41)64(54-7-5-4-6-8-54,56-37-11-42(2)12-38-56,57-39-13-43(3)14-40-57)63-53-33-25-49(26-34-53)59(48-23-31-52(62)32-24-48)45-17-15-44(16-18-45)58(46-19-27-50(60)28-20-46)47-21-29-51(61)30-22-47/h4-40,58-62H,1-3H3 |
| InChIKey | ZBABXWUTWHQMIU-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.03 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|