C13H14ClF2N4+ — CID 153404258
6-[(6-chloro-3-pyridinyl)methyl]-2-N-(2,2-difluoroethyl)pyridin-1-ium-1,2-diamine (PubChem CID 153404258) has the molecular formula C13H14ClF2N4+ and a molecular weight of 299.73 g/mol. Its IUPAC name is 6-[(6-chloro-3-pyridinyl)methyl]-2-N-(2,2-difluoroethyl)pyridin-1-ium-1,2-diamine.
| Compound Name | 6-[(6-chloro-3-pyridinyl)methyl]-2-N-(2,2-difluoroethyl)pyridin-1-ium-1,2-diamine |
|---|---|
| PubChem CID | 153404258 |
| Molecular Formula | C13H14ClF2N4+ |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 6-[(6-chloro-3-pyridinyl)methyl]-2-N-(2,2-difluoroethyl)pyridin-1-ium-1,2-diamine |
| SMILES | N[n+]1c(Cc2ccc(Cl)nc2)cccc1NCC(F)F |
| InChI | InChI=1S/C13H13ClF2N4/c14-11-5-4-9(7-18-11)6-10-2-1-3-13(20(10)17)19-8-12(15)16/h1-5,7,12H,6,8,17H2/p+1 |
| InChIKey | NUWBSICCSRJZLH-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|