C10H18N2 — CID 153404596
4-[(Z)-1-iminobut-2-en-2-yl]cyclohexan-1-amine (PubChem CID 153404596) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 4-[(Z)-1-iminobut-2-en-2-yl]cyclohexan-1-amine.
| Compound Name | 4-[(Z)-1-iminobut-2-en-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 153404596 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 4-[(Z)-1-iminobut-2-en-2-yl]cyclohexan-1-amine |
| SMILES | [H]/N=C/C(=C\C)C1CCC(N)CC1 |
| InChI | InChI=1S/C10H18N2/c1-2-8(7-11)9-3-5-10(12)6-4-9/h2,7,9-11H,3-6,12H2,1H3/b8-2+,11-7+ |
| InChIKey | PETZAJPHLMUHRR-WCYMNSDHSA-N |
| XLogP | 2.10 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|