C13H22N2O2 — CID 153404645
ethane;N-ethyl-2-(hydroxyamino)-2-(3-methylphenyl)acetamide (PubChem CID 153404645) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is ethane;N-ethyl-2-(hydroxyamino)-2-(3-methylphenyl)acetamide.
| Compound Name | ethane;N-ethyl-2-(hydroxyamino)-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 153404645 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | ethane;N-ethyl-2-(hydroxyamino)-2-(3-methylphenyl)acetamide |
| SMILES | CC.CCNC(=O)C(NO)c1cccc(C)c1 |
| InChI | InChI=1S/C11H16N2O2.C2H6/c1-3-12-11(14)10(13-15)9-6-4-5-8(2)7-9;1-2/h4-7,10,13,15H,3H2,1-2H3,(H,12,14);1-2H3 |
| InChIKey | POQBPYWIVIOFGH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|