C33H41FN8O7S — CID 153406310
[3-[4-methoxy-2-(4-methylpiperazin-1-yl)-5-[[5-morpholin-4-yl-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]anilino]-3-oxoprop-1-en-2-yl] carbonofluoridate (PubChem CID 153406310) has the molecular formula C33H41FN8O7S and a molecular weight of 712.81 g/mol. Its IUPAC name is [3-[4-methoxy-2-(4-methylpiperazin-1-yl)-5-[[5-morpholin-4-yl-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]anilino]-3-oxoprop-1-en-2-yl] carbonofluoridate.
| Compound Name | [3-[4-methoxy-2-(4-methylpiperazin-1-yl)-5-[[5-morpholin-4-yl-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]anilino]-3-oxoprop-1-en-2-yl] carbonofluoridate |
|---|---|
| PubChem CID | 153406310 |
| Molecular Formula | C33H41FN8O7S |
| Molecular Weight | 712.81 g/mol |
| Exact Mass | 712.28 |
| IUPAC Name | [3-[4-methoxy-2-(4-methylpiperazin-1-yl)-5-[[5-morpholin-4-yl-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]anilino]-3-oxoprop-1-en-2-yl] carbonofluoridate |
| SMILES | C=C(OC(=O)F)C(=O)Nc1cc(Nc2ncc(N3CCOCC3)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(OC)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C33H41FN8O7S/c1-21(2)50(45,46)29-9-7-6-8-23(29)36-30-27(42-14-16-48-17-15-42)20-35-33(39-30)38-25-18-24(37-31(43)22(3)49-32(34)44)26(19-28(25)47-5)41-12-10-40(4)11-13-41/h6-9,18-21H,3,10-17H2,1-2,4-5H3,(H,37,43)(H2,35,36,38,39) |
| InChIKey | OPNBCRUFKKWNMA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 167.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|