C18H22FN5 — CID 153407955
4-(2,4-dimethyl-2H-pyrimidin-1-yl)-2-fluoro-N-(3-imidazol-1-ylpropyl)aniline (PubChem CID 153407955) has the molecular formula C18H22FN5 and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(2,4-dimethyl-2H-pyrimidin-1-yl)-2-fluoro-N-(3-imidazol-1-ylpropyl)aniline.
| Compound Name | 4-(2,4-dimethyl-2H-pyrimidin-1-yl)-2-fluoro-N-(3-imidazol-1-ylpropyl)aniline |
|---|---|
| PubChem CID | 153407955 |
| Molecular Formula | C18H22FN5 |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-(2,4-dimethyl-2H-pyrimidin-1-yl)-2-fluoro-N-(3-imidazol-1-ylpropyl)aniline |
| SMILES | CC1=NC(C)N(c2ccc(NCCCn3ccnc3)c(F)c2)C=C1 |
| InChI | InChI=1S/C18H22FN5/c1-14-6-10-24(15(2)22-14)16-4-5-18(17(19)12-16)21-7-3-9-23-11-8-20-13-23/h4-6,8,10-13,15,21H,3,7,9H2,1-2H3 |
| InChIKey | NVAQWXZTJSQNQH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|